C11H18Cl2N4 — CID 120846045
(3aR,6aS)-5-[(4-chloro-1-methylpyrazol-5-yl)methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride (PubChem CID 120846045) has the molecular formula C11H18Cl2N4 and a molecular weight of 277.20 g/mol. Its IUPAC name is (3aR,6aS)-5-[(4-chloro-1-methylpyrazol-5-yl)methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride.
| Compound Name | (3aR,6aS)-5-[(4-chloro-1-methylpyrazol-5-yl)methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride |
|---|---|
| PubChem CID | 120846045 |
| Molecular Formula | C11H18Cl2N4 |
| Molecular Weight | 277.20 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | (3aR,6aS)-5-[(4-chloro-1-methylpyrazol-5-yl)methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride |
| SMILES | Cl.Cn1ncc(Cl)c1CN1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C11H17ClN4.ClH/c1-15-11(10(12)4-14-15)7-16-5-8-2-13-3-9(8)6-16;/h4,8-9,13H,2-3,5-7H2,1H3;1H/t8-,9+; |
| InChIKey | VURJEONKNRRLES-UFIFRZAQSA-N |
| XLogP | 1.15 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.20 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |