C13H16N2S — CID 117041305
4-N-methyl-4-N-[(3-methylthiophen-2-yl)methyl]benzene-1,4-diamine (PubChem CID 117041305) has the molecular formula C13H16N2S and a molecular weight of 232.35 g/mol. Its IUPAC name is 4-N-methyl-4-N-[(3-methylthiophen-2-yl)methyl]benzene-1,4-diamine.
| Compound Name | 4-N-methyl-4-N-[(3-methylthiophen-2-yl)methyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 117041305 |
| Molecular Formula | C13H16N2S |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 4-N-methyl-4-N-[(3-methylthiophen-2-yl)methyl]benzene-1,4-diamine |
| SMILES | Cc1ccsc1CN(C)c1ccc(N)cc1 |
| InChI | InChI=1S/C13H16N2S/c1-10-7-8-16-13(10)9-15(2)12-5-3-11(14)4-6-12/h3-8H,9,14H2,1-2H3 |
| InChIKey | IGSJUGBMZPOMOR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|