C17H19N3 — CID 117041625
N-[4-(aminomethyl)phenyl]-N,1-dimethylindol-3-amine (PubChem CID 117041625) has the molecular formula C17H19N3 and a molecular weight of 265.36 g/mol. Its IUPAC name is N-[4-(aminomethyl)phenyl]-N,1-dimethylindol-3-amine.
| Compound Name | N-[4-(aminomethyl)phenyl]-N,1-dimethylindol-3-amine |
|---|---|
| PubChem CID | 117041625 |
| Molecular Formula | C17H19N3 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | N-[4-(aminomethyl)phenyl]-N,1-dimethylindol-3-amine |
| SMILES | CN(c1ccc(CN)cc1)c1cn(C)c2ccccc12 |
| InChI | InChI=1S/C17H19N3/c1-19-12-17(15-5-3-4-6-16(15)19)20(2)14-9-7-13(11-18)8-10-14/h3-10,12H,11,18H2,1-2H3 |
| InChIKey | FFRDKMURTZRPGJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 34.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |