C16H23N3 — CID 115117895
2-N-methyl-2-N-(1-methylindol-3-yl)cyclohexane-1,2-diamine (PubChem CID 115117895) has the molecular formula C16H23N3 and a molecular weight of 257.38 g/mol. Its IUPAC name is 2-N-methyl-2-N-(1-methylindol-3-yl)cyclohexane-1,2-diamine.
| Compound Name | 2-N-methyl-2-N-(1-methylindol-3-yl)cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 115117895 |
| Molecular Formula | C16H23N3 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | 2-N-methyl-2-N-(1-methylindol-3-yl)cyclohexane-1,2-diamine |
| SMILES | CN(c1cn(C)c2ccccc12)C1CCCCC1N |
| InChI | InChI=1S/C16H23N3/c1-18-11-16(12-7-3-5-9-14(12)18)19(2)15-10-6-4-8-13(15)17/h3,5,7,9,11,13,15H,4,6,8,10,17H2,1-2H3 |
| InChIKey | QTPYNVAVUBBWOT-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 34.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |