C10H16N2O2 — CID 117042356
3-methyl-3-[methyl(1H-pyrrol-3-yl)amino]butanoic acid (PubChem CID 117042356) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 3-methyl-3-[methyl(1H-pyrrol-3-yl)amino]butanoic acid.
| Compound Name | 3-methyl-3-[methyl(1H-pyrrol-3-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 117042356 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 3-methyl-3-[methyl(1H-pyrrol-3-yl)amino]butanoic acid |
| SMILES | CN(c1cc[nH]c1)C(C)(C)CC(=O)O |
| InChI | InChI=1S/C10H16N2O2/c1-10(2,6-9(13)14)12(3)8-4-5-11-7-8/h4-5,7,11H,6H2,1-3H3,(H,13,14) |
| InChIKey | OJVNGHSERLNOJC-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |