C15H23NO3 — CID 117042389
3-(4-methoxy-N,3,5-trimethylanilino)-3-methylbutanoic acid (PubChem CID 117042389) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is 3-(4-methoxy-N,3,5-trimethylanilino)-3-methylbutanoic acid.
| Compound Name | 3-(4-methoxy-N,3,5-trimethylanilino)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 117042389 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 3-(4-methoxy-N,3,5-trimethylanilino)-3-methylbutanoic acid |
| SMILES | COc1c(C)cc(N(C)C(C)(C)CC(=O)O)cc1C |
| InChI | InChI=1S/C15H23NO3/c1-10-7-12(8-11(2)14(10)19-6)16(5)15(3,4)9-13(17)18/h7-8H,9H2,1-6H3,(H,17,18) |
| InChIKey | SFWSRNDAWKMBMY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|