C14H23NO4 — CID 115133331
2-methyl-2-(3,4,5-trimethoxy-N-methylanilino)propan-1-ol (PubChem CID 115133331) has the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. Its IUPAC name is 2-methyl-2-(3,4,5-trimethoxy-N-methylanilino)propan-1-ol.
| Compound Name | 2-methyl-2-(3,4,5-trimethoxy-N-methylanilino)propan-1-ol |
|---|---|
| PubChem CID | 115133331 |
| Molecular Formula | C14H23NO4 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 2-methyl-2-(3,4,5-trimethoxy-N-methylanilino)propan-1-ol |
| SMILES | COc1cc(N(C)C(C)(C)CO)cc(OC)c1OC |
| InChI | InChI=1S/C14H23NO4/c1-14(2,9-16)15(3)10-7-11(17-4)13(19-6)12(8-10)18-5/h7-8,16H,9H2,1-6H3 |
| InChIKey | OJWRWEAAPPMJPB-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|