C12H15ClFNO — CID 117048072
2-(4-amino-2-fluorophenyl)-2,3-dimethylbutanoyl chloride (PubChem CID 117048072) has the molecular formula C12H15ClFNO and a molecular weight of 243.71 g/mol. Its IUPAC name is 2-(4-amino-2-fluorophenyl)-2,3-dimethylbutanoyl chloride.
| Compound Name | 2-(4-amino-2-fluorophenyl)-2,3-dimethylbutanoyl chloride |
|---|---|
| PubChem CID | 117048072 |
| Molecular Formula | C12H15ClFNO |
| Molecular Weight | 243.71 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 2-(4-amino-2-fluorophenyl)-2,3-dimethylbutanoyl chloride |
| SMILES | CC(C)C(C)(C(=O)Cl)c1ccc(N)cc1F |
| InChI | InChI=1S/C12H15ClFNO/c1-7(2)12(3,11(13)16)9-5-4-8(15)6-10(9)14/h4-7H,15H2,1-3H3 |
| InChIKey | VDCXKPPLFOATLH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.71 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|