C16H14N2O2 — CID 117048315
2-(4-cyanophenyl)-2-methyl-3-pyridin-3-ylpropanoic acid (PubChem CID 117048315) has the molecular formula C16H14N2O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is 2-(4-cyanophenyl)-2-methyl-3-pyridin-3-ylpropanoic acid.
| Compound Name | 2-(4-cyanophenyl)-2-methyl-3-pyridin-3-ylpropanoic acid |
|---|---|
| PubChem CID | 117048315 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 2-(4-cyanophenyl)-2-methyl-3-pyridin-3-ylpropanoic acid |
| SMILES | CC(Cc1cccnc1)(C(=O)O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C16H14N2O2/c1-16(15(19)20,9-13-3-2-8-18-11-13)14-6-4-12(10-17)5-7-14/h2-8,11H,9H2,1H3,(H,19,20) |
| InChIKey | UPCXMVVAMRIYCI-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 73.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |