C18H19NO2 — CID 117048309
2-(4-cyclopropylphenyl)-2-methyl-3-pyridin-3-ylpropanoic acid (PubChem CID 117048309) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is 2-(4-cyclopropylphenyl)-2-methyl-3-pyridin-3-ylpropanoic acid.
| Compound Name | 2-(4-cyclopropylphenyl)-2-methyl-3-pyridin-3-ylpropanoic acid |
|---|---|
| PubChem CID | 117048309 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 2-(4-cyclopropylphenyl)-2-methyl-3-pyridin-3-ylpropanoic acid |
| SMILES | CC(Cc1cccnc1)(C(=O)O)c1ccc(C2CC2)cc1 |
| InChI | InChI=1S/C18H19NO2/c1-18(17(20)21,11-13-3-2-10-19-12-13)16-8-6-15(7-9-16)14-4-5-14/h2-3,6-10,12,14H,4-5,11H2,1H3,(H,20,21) |
| InChIKey | JJQMFUQNQXTZHX-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |