C14H11ClF2O2 — CID 117048691
2-(3,5-difluorophenyl)-3-(furan-2-yl)-2-methylpropanoyl chloride (PubChem CID 117048691) has the molecular formula C14H11ClF2O2 and a molecular weight of 284.69 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)-3-(furan-2-yl)-2-methylpropanoyl chloride.
| Compound Name | 2-(3,5-difluorophenyl)-3-(furan-2-yl)-2-methylpropanoyl chloride |
|---|---|
| PubChem CID | 117048691 |
| Molecular Formula | C14H11ClF2O2 |
| Molecular Weight | 284.69 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 2-(3,5-difluorophenyl)-3-(furan-2-yl)-2-methylpropanoyl chloride |
| SMILES | CC(Cc1ccco1)(C(=O)Cl)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C14H11ClF2O2/c1-14(13(15)18,8-12-3-2-4-19-12)9-5-10(16)7-11(17)6-9/h2-7H,8H2,1H3 |
| InChIKey | SWSIGBQOBOIVQY-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.69 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|