C18H19ClOS — CID 117048916
2-methyl-2-(5,6,7,8-tetrahydronaphthalen-2-yl)-3-thiophen-2-ylpropanoyl chloride (PubChem CID 117048916) has the molecular formula C18H19ClOS and a molecular weight of 318.87 g/mol. Its IUPAC name is 2-methyl-2-(5,6,7,8-tetrahydronaphthalen-2-yl)-3-thiophen-2-ylpropanoyl chloride.
| Compound Name | 2-methyl-2-(5,6,7,8-tetrahydronaphthalen-2-yl)-3-thiophen-2-ylpropanoyl chloride |
|---|---|
| PubChem CID | 117048916 |
| Molecular Formula | C18H19ClOS |
| Molecular Weight | 318.87 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 2-methyl-2-(5,6,7,8-tetrahydronaphthalen-2-yl)-3-thiophen-2-ylpropanoyl chloride |
| SMILES | CC(Cc1cccs1)(C(=O)Cl)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C18H19ClOS/c1-18(17(19)20,12-16-7-4-10-21-16)15-9-8-13-5-2-3-6-14(13)11-15/h4,7-11H,2-3,5-6,12H2,1H3 |
| InChIKey | KNBDGFVJIOFUPA-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.87 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|