C16H20O2 — CID 117049182
2-methyl-2-(5,6,7,8-tetrahydronaphthalen-2-yl)pent-4-enoic acid (PubChem CID 117049182) has the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. Its IUPAC name is 2-methyl-2-(5,6,7,8-tetrahydronaphthalen-2-yl)pent-4-enoic acid.
| Compound Name | 2-methyl-2-(5,6,7,8-tetrahydronaphthalen-2-yl)pent-4-enoic acid |
|---|---|
| PubChem CID | 117049182 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | 2-methyl-2-(5,6,7,8-tetrahydronaphthalen-2-yl)pent-4-enoic acid |
| SMILES | C=CCC(C)(C(=O)O)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C16H20O2/c1-3-10-16(2,15(17)18)14-9-8-12-6-4-5-7-13(12)11-14/h3,8-9,11H,1,4-7,10H2,2H3,(H,17,18) |
| InChIKey | RWAPWJMOTCJLSF-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|