C11H8F2N2 — CID 117049545
2-(2,6-difluorophenyl)-2-methylbutanedinitrile (PubChem CID 117049545) has the molecular formula C11H8F2N2 and a molecular weight of 206.19 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-2-methylbutanedinitrile.
| Compound Name | 2-(2,6-difluorophenyl)-2-methylbutanedinitrile |
|---|---|
| PubChem CID | 117049545 |
| Molecular Formula | C11H8F2N2 |
| Molecular Weight | 206.19 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 2-(2,6-difluorophenyl)-2-methylbutanedinitrile |
| SMILES | CC(C#N)(CC#N)c1c(F)cccc1F |
| InChI | InChI=1S/C11H8F2N2/c1-11(7-15,5-6-14)10-8(12)3-2-4-9(10)13/h2-4H,5H2,1H3 |
| InChIKey | HGYGNDIJEITUMR-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.19 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |