C27H27BF6O6 — CID 171472562
tris[2-(2,6-difluorophenyl)propan-2-yloxy] borate (PubChem CID 171472562) has the molecular formula C27H27BF6O6 and a molecular weight of 572.31 g/mol. Its IUPAC name is tris[2-(2,6-difluorophenyl)propan-2-yloxy] borate.
| Compound Name | tris[2-(2,6-difluorophenyl)propan-2-yloxy] borate |
|---|---|
| PubChem CID | 171472562 |
| Molecular Formula | C27H27BF6O6 |
| Molecular Weight | 572.31 g/mol |
| Exact Mass | 572.18 |
| IUPAC Name | tris[2-(2,6-difluorophenyl)propan-2-yloxy] borate |
| SMILES | CC(C)(OOB(OOC(C)(C)c1c(F)cccc1F)OOC(C)(C)c1c(F)cccc1F)c1c(F)cccc1F |
| InChI | InChI=1S/C27H27BF6O6/c1-25(2,22-16(29)10-7-11-17(22)30)35-38-28(39-36-26(3,4)23-18(31)12-8-13-19(23)32)40-37-27(5,6)24-20(33)14-9-15-21(24)34/h7-15H,1-6H3 |
| InChIKey | CLKYLNRBFDMZHG-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.31 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|