C11H11F2NO4 — CID 117050102
2-(6-amino-2,3-difluorophenyl)-2-methylbutanedioic acid (PubChem CID 117050102) has the molecular formula C11H11F2NO4 and a molecular weight of 259.21 g/mol. Its IUPAC name is 2-(6-amino-2,3-difluorophenyl)-2-methylbutanedioic acid.
| Compound Name | 2-(6-amino-2,3-difluorophenyl)-2-methylbutanedioic acid |
|---|---|
| PubChem CID | 117050102 |
| Molecular Formula | C11H11F2NO4 |
| Molecular Weight | 259.21 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 2-(6-amino-2,3-difluorophenyl)-2-methylbutanedioic acid |
| SMILES | CC(CC(=O)O)(C(=O)O)c1c(N)ccc(F)c1F |
| InChI | InChI=1S/C11H11F2NO4/c1-11(10(17)18,4-7(15)16)8-6(14)3-2-5(12)9(8)13/h2-3H,4,14H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | OUFMILXEGCCELI-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.21 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|