C15H21N3O — CID 117050463
[5-(2-aminoethyl)-2-azabicyclo[2.2.2]octan-2-yl]-pyridin-3-ylmethanone (PubChem CID 117050463) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is [5-(2-aminoethyl)-2-azabicyclo[2.2.2]octan-2-yl]-pyridin-3-ylmethanone.
| Compound Name | [5-(2-aminoethyl)-2-azabicyclo[2.2.2]octan-2-yl]-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 117050463 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | [5-(2-aminoethyl)-2-azabicyclo[2.2.2]octan-2-yl]-pyridin-3-ylmethanone |
| SMILES | NCCC1CC2CCC1CN2C(=O)c1cccnc1 |
| InChI | InChI=1S/C15H21N3O/c16-6-5-11-8-14-4-3-13(11)10-18(14)15(19)12-2-1-7-17-9-12/h1-2,7,9,11,13-14H,3-6,8,10,16H2 |
| InChIKey | BVGOPQDAUSJGCM-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |