C11H12N2OS — CID 122270184
pyridin-3-yl(2-thia-5-azabicyclo[2.2.1]heptan-5-yl)methanone (PubChem CID 122270184) has the molecular formula C11H12N2OS and a molecular weight of 220.30 g/mol. Its IUPAC name is pyridin-3-yl(2-thia-5-azabicyclo[2.2.1]heptan-5-yl)methanone.
| Compound Name | pyridin-3-yl(2-thia-5-azabicyclo[2.2.1]heptan-5-yl)methanone |
|---|---|
| PubChem CID | 122270184 |
| Molecular Formula | C11H12N2OS |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | pyridin-3-yl(2-thia-5-azabicyclo[2.2.1]heptan-5-yl)methanone |
| SMILES | O=C(c1cccnc1)N1CC2CC1CS2 |
| InChI | InChI=1S/C11H12N2OS/c14-11(8-2-1-3-12-5-8)13-6-10-4-9(13)7-15-10/h1-3,5,9-10H,4,6-7H2 |
| InChIKey | DUWSIBVKLZABJI-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |