C12H10N2O3 — CID 117052908
3-methoxy-2-(1,2-oxazol-3-ylmethoxy)benzonitrile (PubChem CID 117052908) has the molecular formula C12H10N2O3 and a molecular weight of 230.22 g/mol. Its IUPAC name is 3-methoxy-2-(1,2-oxazol-3-ylmethoxy)benzonitrile.
| Compound Name | 3-methoxy-2-(1,2-oxazol-3-ylmethoxy)benzonitrile |
|---|---|
| PubChem CID | 117052908 |
| Molecular Formula | C12H10N2O3 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 3-methoxy-2-(1,2-oxazol-3-ylmethoxy)benzonitrile |
| SMILES | COc1cccc(C#N)c1OCc1ccon1 |
| InChI | InChI=1S/C12H10N2O3/c1-15-11-4-2-3-9(7-13)12(11)16-8-10-5-6-17-14-10/h2-6H,8H2,1H3 |
| InChIKey | SFQAYCFPZPPFJZ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |