methyl 2-[3-methoxy-2-(1,2-oxazol-3-ylmethoxy)phenyl]acetate

C14H15NO5 — CID 122142295

IUPACmethyl 2-[3-methoxy-2-(1,2-oxazol-3-ylmethoxy)phenyl]acetate
SMILESCOC(=O)Cc1cccc(OC)c1OCc1ccon1
InChIInChI=1S/C14H15NO5/c1-17-12-5-3-4-10(8-13(16)18-2)14(12)19-9-11-6-7-20-15-11/h3-7H,8-9H2,1-2H3
InChIKeyJBZRCDZDZXKDIJ-UHFFFAOYSA-N
MW277.28 g/mol
LogP1.98
Rot. Bonds6

About methyl 2-[3-methoxy-2-(1,2-oxazol-3-ylmethoxy)phenyl]acetate

methyl 2-[3-methoxy-2-(1,2-oxazol-3-ylmethoxy)phenyl]acetate (PubChem CID 122142295) has the molecular formula C14H15NO5 and a molecular weight of 277.28 g/mol. Its IUPAC name is methyl 2-[3-methoxy-2-(1,2-oxazol-3-ylmethoxy)phenyl]acetate.

Molecular Properties

Compound Namemethyl 2-[3-methoxy-2-(1,2-oxazol-3-ylmethoxy)phenyl]acetate
PubChem CID122142295
Molecular FormulaC14H15NO5
Molecular Weight277.28 g/mol
Exact Mass277.10
IUPAC Namemethyl 2-[3-methoxy-2-(1,2-oxazol-3-ylmethoxy)phenyl]acetate
SMILESCOC(=O)Cc1cccc(OC)c1OCc1ccon1
InChIInChI=1S/C14H15NO5/c1-17-12-5-3-4-10(8-13(16)18-2)14(12)19-9-11-6-7-20-15-11/h3-7H,8-9H2,1-2H3
InChIKeyJBZRCDZDZXKDIJ-UHFFFAOYSA-N
XLogP1.98
TPSA70.79 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds6
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500277.28
LogP ≤ 51.98
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze methyl 2-[3-methoxy-2-(1,2-oxazol-3-ylmethoxy)phenyl]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[3-methoxy-2-(1,2-oxazol-3-ylmethoxy)phenyl]acetate?
The IUPAC name of methyl 2-[3-methoxy-2-(1,2-oxazol-3-ylmethoxy)phenyl]acetate (CID 122142295) is methyl 2-[3-methoxy-2-(1,2-oxazol-3-ylmethoxy)phenyl]acetate.
What is the SMILES notation for methyl 2-[3-methoxy-2-(1,2-oxazol-3-ylmethoxy)phenyl]acetate?
The canonical SMILES for methyl 2-[3-methoxy-2-(1,2-oxazol-3-ylmethoxy)phenyl]acetate is COC(=O)Cc1cccc(OC)c1OCc1ccon1.
What is the InChIKey of methyl 2-[3-methoxy-2-(1,2-oxazol-3-ylmethoxy)phenyl]acetate?
The InChIKey is JBZRCDZDZXKDIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO5/c1-17-12-5-3-4-10(8-13(16)18-2)14(12)19-9-11-6-7-20-15-11/h3-7H,8-9H2,1-2H3.
What are the key properties of methyl 2-[3-methoxy-2-(1,2-oxazol-3-ylmethoxy)phenyl]acetate?
methyl 2-[3-methoxy-2-(1,2-oxazol-3-ylmethoxy)phenyl]acetate has a molecular weight of 277.28 g/mol, XLogP of 1.98, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[3-methoxy-2-(1,2-oxazol-3-ylmethoxy)phenyl]acetate is sourced from PubChem (CID 122142295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).