C21H21NO3S — CID 117055160
(E)-1-[3-(1,3-benzodioxol-5-yl)pyrrolidin-1-yl]-3-(4-methylsulfanylphenyl)prop-2-en-1-one (PubChem CID 117055160) has the molecular formula C21H21NO3S and a molecular weight of 367.47 g/mol. Its IUPAC name is (E)-1-[3-(1,3-benzodioxol-5-yl)pyrrolidin-1-yl]-3-(4-methylsulfanylphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[3-(1,3-benzodioxol-5-yl)pyrrolidin-1-yl]-3-(4-methylsulfanylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 117055160 |
| Molecular Formula | C21H21NO3S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | (E)-1-[3-(1,3-benzodioxol-5-yl)pyrrolidin-1-yl]-3-(4-methylsulfanylphenyl)prop-2-en-1-one |
| SMILES | CSc1ccc(/C=C/C(=O)N2CCC(c3ccc4c(c3)OCO4)C2)cc1 |
| InChI | InChI=1S/C21H21NO3S/c1-26-18-6-2-15(3-7-18)4-9-21(23)22-11-10-17(13-22)16-5-8-19-20(12-16)25-14-24-19/h2-9,12,17H,10-11,13-14H2,1H3/b9-4+ |
| InChIKey | CJZOVIAIHXQGFY-RUDMXATFSA-N |
| XLogP | 4.17 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|