C19H19NO2S — CID 126853450
(E)-1-[3-(2,3-dihydro-1-benzofuran-5-yl)pyrrolidin-1-yl]-3-thiophen-3-ylprop-2-en-1-one (PubChem CID 126853450) has the molecular formula C19H19NO2S and a molecular weight of 325.43 g/mol. Its IUPAC name is (E)-1-[3-(2,3-dihydro-1-benzofuran-5-yl)pyrrolidin-1-yl]-3-thiophen-3-ylprop-2-en-1-one.
| Compound Name | (E)-1-[3-(2,3-dihydro-1-benzofuran-5-yl)pyrrolidin-1-yl]-3-thiophen-3-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 126853450 |
| Molecular Formula | C19H19NO2S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | (E)-1-[3-(2,3-dihydro-1-benzofuran-5-yl)pyrrolidin-1-yl]-3-thiophen-3-ylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccsc1)N1CCC(c2ccc3c(c2)CCO3)C1 |
| InChI | InChI=1S/C19H19NO2S/c21-19(4-1-14-7-10-23-13-14)20-8-5-17(12-20)15-2-3-18-16(11-15)6-9-22-18/h1-4,7,10-11,13,17H,5-6,8-9,12H2/b4-1+ |
| InChIKey | IJXHJLCCKUBAJF-DAFODLJHSA-N |
| XLogP | 3.71 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|