C16H17NOS2 — CID 71960797
3-thiophen-3-yl-1-(4-thiophen-2-ylpiperidin-1-yl)prop-2-en-1-one (PubChem CID 71960797) has the molecular formula C16H17NOS2 and a molecular weight of 303.45 g/mol. Its IUPAC name is 3-thiophen-3-yl-1-(4-thiophen-2-ylpiperidin-1-yl)prop-2-en-1-one.
| Compound Name | 3-thiophen-3-yl-1-(4-thiophen-2-ylpiperidin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 71960797 |
| Molecular Formula | C16H17NOS2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 3-thiophen-3-yl-1-(4-thiophen-2-ylpiperidin-1-yl)prop-2-en-1-one |
| SMILES | O=C(C=Cc1ccsc1)N1CCC(c2cccs2)CC1 |
| InChI | InChI=1S/C16H17NOS2/c18-16(4-3-13-7-11-19-12-13)17-8-5-14(6-9-17)15-2-1-10-20-15/h1-4,7,10-12,14H,5-6,8-9H2 |
| InChIKey | DSOWZZDYXKVGSO-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|