C20H15BrN4O4S — CID 117055931
7-acetyl-6-(6-bromo-1,3-benzodioxol-5-yl)-3-methylsulfanyl-6H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-olate (PubChem CID 117055931) has the molecular formula C20H15BrN4O4S and a molecular weight of 487.34 g/mol. Its IUPAC name is 7-acetyl-6-(6-bromo-1,3-benzodioxol-5-yl)-3-methylsulfanyl-6H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-olate.
| Compound Name | 7-acetyl-6-(6-bromo-1,3-benzodioxol-5-yl)-3-methylsulfanyl-6H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-olate |
|---|---|
| PubChem CID | 117055931 |
| Molecular Formula | C20H15BrN4O4S |
| Molecular Weight | 487.34 g/mol |
| Exact Mass | 486.00 |
| IUPAC Name | 7-acetyl-6-(6-bromo-1,3-benzodioxol-5-yl)-3-methylsulfanyl-6H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-olate |
| SMILES | CSc1nc([O-])c2[n+](n1)C(c1cc3c(cc1Br)OCO3)N(C(C)=O)c1ccccc1-2 |
| InChI | InChI=1S/C20H15BrN4O4S/c1-10(26)24-14-6-4-3-5-11(14)17-18(27)22-20(30-2)23-25(17)19(24)12-7-15-16(8-13(12)21)29-9-28-15/h3-8,19H,9H2,1-2H3 |
| InChIKey | WEDQDQUHIRCKCV-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 91.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|