C27H21BrN4O4S — CID 117057536
7-acetyl-6-(5-acetyloxy-2-bromophenyl)-3-benzylsulfanyl-6H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-olate (PubChem CID 117057536) has the molecular formula C27H21BrN4O4S and a molecular weight of 577.46 g/mol. Its IUPAC name is 7-acetyl-6-(5-acetyloxy-2-bromophenyl)-3-benzylsulfanyl-6H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-olate.
| Compound Name | 7-acetyl-6-(5-acetyloxy-2-bromophenyl)-3-benzylsulfanyl-6H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-olate |
|---|---|
| PubChem CID | 117057536 |
| Molecular Formula | C27H21BrN4O4S |
| Molecular Weight | 577.46 g/mol |
| Exact Mass | 576.05 |
| IUPAC Name | 7-acetyl-6-(5-acetyloxy-2-bromophenyl)-3-benzylsulfanyl-6H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-olate |
| SMILES | CC(=O)Oc1ccc(Br)c(C2N(C(C)=O)c3ccccc3-c3c([O-])nc(SCc4ccccc4)n[n+]32)c1 |
| InChI | InChI=1S/C27H21BrN4O4S/c1-16(33)31-23-11-7-6-10-20(23)24-25(35)29-27(37-15-18-8-4-3-5-9-18)30-32(24)26(31)21-14-19(36-17(2)34)12-13-22(21)28/h3-14,26H,15H2,1-2H3 |
| InChIKey | SFJYCVJHFKNNFY-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 99.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.46 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|