C23H22N4O5S — CID 117055508
7-acetyl-6-(4-acetyloxy-3-methoxyphenyl)-3-ethylsulfanyl-6H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-olate (PubChem CID 117055508) has the molecular formula C23H22N4O5S and a molecular weight of 466.52 g/mol. Its IUPAC name is 7-acetyl-6-(4-acetyloxy-3-methoxyphenyl)-3-ethylsulfanyl-6H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-olate.
| Compound Name | 7-acetyl-6-(4-acetyloxy-3-methoxyphenyl)-3-ethylsulfanyl-6H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-olate |
|---|---|
| PubChem CID | 117055508 |
| Molecular Formula | C23H22N4O5S |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | 7-acetyl-6-(4-acetyloxy-3-methoxyphenyl)-3-ethylsulfanyl-6H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-olate |
| SMILES | CCSc1nc([O-])c2[n+](n1)C(c1ccc(OC(C)=O)c(OC)c1)N(C(C)=O)c1ccccc1-2 |
| InChI | InChI=1S/C23H22N4O5S/c1-5-33-23-24-21(30)20-16-8-6-7-9-17(16)26(13(2)28)22(27(20)25-23)15-10-11-18(32-14(3)29)19(12-15)31-4/h6-12,22H,5H2,1-4H3 |
| InChIKey | ZIWXMKPOVDZBSP-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 108.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|