C24H24N4O3S — CID 117057176
7-acetyl-6-(4-ethoxy-3-methylphenyl)-3-prop-2-enylsulfanyl-6H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-olate (PubChem CID 117057176) has the molecular formula C24H24N4O3S and a molecular weight of 448.55 g/mol. Its IUPAC name is 7-acetyl-6-(4-ethoxy-3-methylphenyl)-3-prop-2-enylsulfanyl-6H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-olate.
| Compound Name | 7-acetyl-6-(4-ethoxy-3-methylphenyl)-3-prop-2-enylsulfanyl-6H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-olate |
|---|---|
| PubChem CID | 117057176 |
| Molecular Formula | C24H24N4O3S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 7-acetyl-6-(4-ethoxy-3-methylphenyl)-3-prop-2-enylsulfanyl-6H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-olate |
| SMILES | C=CCSc1nc([O-])c2[n+](n1)C(c1ccc(OCC)c(C)c1)N(C(C)=O)c1ccccc1-2 |
| InChI | InChI=1S/C24H24N4O3S/c1-5-13-32-24-25-22(30)21-18-9-7-8-10-19(18)27(16(4)29)23(28(21)26-24)17-11-12-20(31-6-2)15(3)14-17/h5,7-12,14,23H,1,6,13H2,2-4H3 |
| InChIKey | FSLMKCKSZLOHLQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 82.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|