C24H27N4O4S+ — CID 137188215
(6S)-7-acetyl-6-(3,4-diethoxyphenyl)-3-ethylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one (PubChem CID 137188215) has the molecular formula C24H27N4O4S+ and a molecular weight of 467.57 g/mol. Its IUPAC name is (6S)-7-acetyl-6-(3,4-diethoxyphenyl)-3-ethylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one.
| Compound Name | (6S)-7-acetyl-6-(3,4-diethoxyphenyl)-3-ethylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
|---|---|
| PubChem CID | 137188215 |
| Molecular Formula | C24H27N4O4S+ |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | (6S)-7-acetyl-6-(3,4-diethoxyphenyl)-3-ethylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
| SMILES | CCOc1ccc([C@H]2N(C(C)=O)c3ccccc3-c3c(=O)[nH]c(SCC)n[n+]32)cc1OCC |
| InChI | InChI=1S/C24H26N4O4S/c1-5-31-19-13-12-16(14-20(19)32-6-2)23-27(15(4)29)18-11-9-8-10-17(18)21-22(30)25-24(33-7-3)26-28(21)23/h8-14,23H,5-7H2,1-4H3/p+1/t23-/m0/s1 |
| InChIKey | PPNDMVPUVMAXPR-QHCPKHFHSA-O |
| XLogP | 3.55 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|