C22H22IN4O4S+ — CID 137187839
(6R)-7-acetyl-3-ethylsulfanyl-6-(3-iodo-4,5-dimethoxyphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one (PubChem CID 137187839) has the molecular formula C22H22IN4O4S+ and a molecular weight of 565.41 g/mol. Its IUPAC name is (6R)-7-acetyl-3-ethylsulfanyl-6-(3-iodo-4,5-dimethoxyphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one.
| Compound Name | (6R)-7-acetyl-3-ethylsulfanyl-6-(3-iodo-4,5-dimethoxyphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
|---|---|
| PubChem CID | 137187839 |
| Molecular Formula | C22H22IN4O4S+ |
| Molecular Weight | 565.41 g/mol |
| Exact Mass | 565.04 |
| IUPAC Name | (6R)-7-acetyl-3-ethylsulfanyl-6-(3-iodo-4,5-dimethoxyphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
| SMILES | CCSc1n[n+]2c(c(=O)[nH]1)-c1ccccc1N(C(C)=O)[C@H]2c1cc(I)c(OC)c(OC)c1 |
| InChI | InChI=1S/C22H21IN4O4S/c1-5-32-22-24-20(29)18-14-8-6-7-9-16(14)26(12(2)28)21(27(18)25-22)13-10-15(23)19(31-4)17(11-13)30-3/h6-11,21H,5H2,1-4H3/p+1/t21-/m1/s1 |
| InChIKey | FLXOVHYWDACLBP-OAQYLSRUSA-O |
| XLogP | 3.37 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.41 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|