C22H23N4O3S+ — CID 137188884
(6S)-7-acetyl-6-(4-ethoxyphenyl)-3-ethylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one (PubChem CID 137188884) has the molecular formula C22H23N4O3S+ and a molecular weight of 423.52 g/mol. Its IUPAC name is (6S)-7-acetyl-6-(4-ethoxyphenyl)-3-ethylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one.
| Compound Name | (6S)-7-acetyl-6-(4-ethoxyphenyl)-3-ethylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
|---|---|
| PubChem CID | 137188884 |
| Molecular Formula | C22H23N4O3S+ |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | (6S)-7-acetyl-6-(4-ethoxyphenyl)-3-ethylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
| SMILES | CCOc1ccc([C@H]2N(C(C)=O)c3ccccc3-c3c(=O)[nH]c(SCC)n[n+]32)cc1 |
| InChI | InChI=1S/C22H22N4O3S/c1-4-29-16-12-10-15(11-13-16)21-25(14(3)27)18-9-7-6-8-17(18)19-20(28)23-22(30-5-2)24-26(19)21/h6-13,21H,4-5H2,1-3H3/p+1/t21-/m0/s1 |
| InChIKey | MKEHAUPMZIFCHW-NRFANRHFSA-O |
| XLogP | 3.15 |
| TPSA | 79.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|