C23H25N4O5S+ — CID 137189478
(6R)-7-acetyl-3-ethylsulfanyl-6-(3,4,5-trimethoxyphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one (PubChem CID 137189478) has the molecular formula C23H25N4O5S+ and a molecular weight of 469.54 g/mol. Its IUPAC name is (6R)-7-acetyl-3-ethylsulfanyl-6-(3,4,5-trimethoxyphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one.
| Compound Name | (6R)-7-acetyl-3-ethylsulfanyl-6-(3,4,5-trimethoxyphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
|---|---|
| PubChem CID | 137189478 |
| Molecular Formula | C23H25N4O5S+ |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | (6R)-7-acetyl-3-ethylsulfanyl-6-(3,4,5-trimethoxyphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
| SMILES | CCSc1n[n+]2c(c(=O)[nH]1)-c1ccccc1N(C(C)=O)[C@H]2c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C23H24N4O5S/c1-6-33-23-24-21(29)19-15-9-7-8-10-16(15)26(13(2)28)22(27(19)25-23)14-11-17(30-3)20(32-5)18(12-14)31-4/h7-12,22H,6H2,1-5H3/p+1/t22-/m1/s1 |
| InChIKey | WJJJZHVLXGBCJQ-JOCHJYFZSA-O |
| XLogP | 2.78 |
| TPSA | 97.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|