C22H23N4O5S+ — CID 136939215
7-acetyl-3-methylsulfanyl-6-(3,4,5-trimethoxyphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one (PubChem CID 136939215) has the molecular formula C22H23N4O5S+ and a molecular weight of 455.52 g/mol. Its IUPAC name is 7-acetyl-3-methylsulfanyl-6-(3,4,5-trimethoxyphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one.
| Compound Name | 7-acetyl-3-methylsulfanyl-6-(3,4,5-trimethoxyphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
|---|---|
| PubChem CID | 136939215 |
| Molecular Formula | C22H23N4O5S+ |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | 7-acetyl-3-methylsulfanyl-6-(3,4,5-trimethoxyphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
| SMILES | COc1cc(C2N(C(C)=O)c3ccccc3-c3c(=O)[nH]c(SC)n[n+]32)cc(OC)c1OC |
| InChI | InChI=1S/C22H22N4O5S/c1-12(27)25-15-9-7-6-8-14(15)18-20(28)23-22(32-5)24-26(18)21(25)13-10-16(29-2)19(31-4)17(11-13)30-3/h6-11,21H,1-5H3/p+1 |
| InChIKey | RUEJCLLIVWEYJB-UHFFFAOYSA-O |
| XLogP | 2.39 |
| TPSA | 97.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|