C25H27N4O6S+ — CID 137189449
[2,6-dimethoxy-4-[(6R)-3-methylsulfanyl-1-oxo-7-propanoyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-6-yl]phenyl] propanoate (PubChem CID 137189449) has the molecular formula C25H27N4O6S+ and a molecular weight of 511.58 g/mol. Its IUPAC name is [2,6-dimethoxy-4-[(6R)-3-methylsulfanyl-1-oxo-7-propanoyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-6-yl]phenyl] propanoate.
| Compound Name | [2,6-dimethoxy-4-[(6R)-3-methylsulfanyl-1-oxo-7-propanoyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-6-yl]phenyl] propanoate |
|---|---|
| PubChem CID | 137189449 |
| Molecular Formula | C25H27N4O6S+ |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.16 |
| IUPAC Name | [2,6-dimethoxy-4-[(6R)-3-methylsulfanyl-1-oxo-7-propanoyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-6-yl]phenyl] propanoate |
| SMILES | CCC(=O)Oc1c(OC)cc([C@@H]2N(C(=O)CC)c3ccccc3-c3c(=O)[nH]c(SC)n[n+]32)cc1OC |
| InChI | InChI=1S/C25H26N4O6S/c1-6-19(30)28-16-11-9-8-10-15(16)21-23(32)26-25(36-5)27-29(21)24(28)14-12-17(33-3)22(18(13-14)34-4)35-20(31)7-2/h8-13,24H,6-7H2,1-5H3/p+1/t24-/m1/s1 |
| InChIKey | WADFQXCYRKGERB-XMMPIXPASA-O |
| XLogP | 3.08 |
| TPSA | 114.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|