C25H27N4O5S+ — CID 137187987
[2-ethoxy-4-[(6R)-3-methylsulfanyl-1-oxo-7-propanoyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-6-yl]phenyl] propanoate (PubChem CID 137187987) has the molecular formula C25H27N4O5S+ and a molecular weight of 495.58 g/mol. Its IUPAC name is [2-ethoxy-4-[(6R)-3-methylsulfanyl-1-oxo-7-propanoyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-6-yl]phenyl] propanoate.
| Compound Name | [2-ethoxy-4-[(6R)-3-methylsulfanyl-1-oxo-7-propanoyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-6-yl]phenyl] propanoate |
|---|---|
| PubChem CID | 137187987 |
| Molecular Formula | C25H27N4O5S+ |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | [2-ethoxy-4-[(6R)-3-methylsulfanyl-1-oxo-7-propanoyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-6-yl]phenyl] propanoate |
| SMILES | CCOc1cc([C@@H]2N(C(=O)CC)c3ccccc3-c3c(=O)[nH]c(SC)n[n+]32)ccc1OC(=O)CC |
| InChI | InChI=1S/C25H26N4O5S/c1-5-20(30)28-17-11-9-8-10-16(17)22-23(32)26-25(35-4)27-29(22)24(28)15-12-13-18(34-21(31)6-2)19(14-15)33-7-3/h8-14,24H,5-7H2,1-4H3/p+1/t24-/m1/s1 |
| InChIKey | DFAOSAMYYFZSBY-XMMPIXPASA-O |
| XLogP | 3.46 |
| TPSA | 105.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|