C29H28IN4O4S+ — CID 137189224
(6R)-6-(3-ethoxy-5-iodo-4-phenylmethoxyphenyl)-3-methylsulfanyl-7-propanoyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one (PubChem CID 137189224) has the molecular formula C29H28IN4O4S+ and a molecular weight of 655.54 g/mol. Its IUPAC name is (6R)-6-(3-ethoxy-5-iodo-4-phenylmethoxyphenyl)-3-methylsulfanyl-7-propanoyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one.
| Compound Name | (6R)-6-(3-ethoxy-5-iodo-4-phenylmethoxyphenyl)-3-methylsulfanyl-7-propanoyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
|---|---|
| PubChem CID | 137189224 |
| Molecular Formula | C29H28IN4O4S+ |
| Molecular Weight | 655.54 g/mol |
| Exact Mass | 655.09 |
| IUPAC Name | (6R)-6-(3-ethoxy-5-iodo-4-phenylmethoxyphenyl)-3-methylsulfanyl-7-propanoyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
| SMILES | CCOc1cc([C@@H]2N(C(=O)CC)c3ccccc3-c3c(=O)[nH]c(SC)n[n+]32)cc(I)c1OCc1ccccc1 |
| InChI | InChI=1S/C29H27IN4O4S/c1-4-24(35)33-22-14-10-9-13-20(22)25-27(36)31-29(39-3)32-34(25)28(33)19-15-21(30)26(23(16-19)37-5-2)38-17-18-11-7-6-8-12-18/h6-16,28H,4-5,17H2,1-3H3/p+1/t28-/m1/s1 |
| InChIKey | RLXRCRFDHNBDLR-MUUNZHRXSA-O |
| XLogP | 5.33 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.54 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|