C21H21N4O2S+ — CID 136939811
7-butanoyl-3-methylsulfanyl-6-phenyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one (PubChem CID 136939811) has the molecular formula C21H21N4O2S+ and a molecular weight of 393.49 g/mol. Its IUPAC name is 7-butanoyl-3-methylsulfanyl-6-phenyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one.
| Compound Name | 7-butanoyl-3-methylsulfanyl-6-phenyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
|---|---|
| PubChem CID | 136939811 |
| Molecular Formula | C21H21N4O2S+ |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 7-butanoyl-3-methylsulfanyl-6-phenyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
| SMILES | CCCC(=O)N1c2ccccc2-c2c(=O)[nH]c(SC)n[n+]2C1c1ccccc1 |
| InChI | InChI=1S/C21H20N4O2S/c1-3-9-17(26)24-16-13-8-7-12-15(16)18-19(27)22-21(28-2)23-25(18)20(24)14-10-5-4-6-11-14/h4-8,10-13,20H,3,9H2,1-2H3/p+1 |
| InChIKey | CVWANFLLDFCFCR-UHFFFAOYSA-O |
| XLogP | 3.14 |
| TPSA | 69.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|