C19H19N4O3S+ — CID 136939822
7-butanoyl-6-(furan-2-yl)-3-methylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one (PubChem CID 136939822) has the molecular formula C19H19N4O3S+ and a molecular weight of 383.45 g/mol. Its IUPAC name is 7-butanoyl-6-(furan-2-yl)-3-methylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one.
| Compound Name | 7-butanoyl-6-(furan-2-yl)-3-methylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
|---|---|
| PubChem CID | 136939822 |
| Molecular Formula | C19H19N4O3S+ |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 7-butanoyl-6-(furan-2-yl)-3-methylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
| SMILES | CCCC(=O)N1c2ccccc2-c2c(=O)[nH]c(SC)n[n+]2C1c1ccco1 |
| InChI | InChI=1S/C19H18N4O3S/c1-3-7-15(24)22-13-9-5-4-8-12(13)16-17(25)20-19(27-2)21-23(16)18(22)14-10-6-11-26-14/h4-6,8-11,18H,3,7H2,1-2H3/p+1 |
| InChIKey | GUMHOBPYLZKCEY-UHFFFAOYSA-O |
| XLogP | 2.73 |
| TPSA | 83.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|