C21H19Cl2N4O2S+ — CID 137189239
(6R)-7-butanoyl-6-(2,3-dichlorophenyl)-3-methylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one (PubChem CID 137189239) has the molecular formula C21H19Cl2N4O2S+ and a molecular weight of 462.38 g/mol. Its IUPAC name is (6R)-7-butanoyl-6-(2,3-dichlorophenyl)-3-methylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one.
| Compound Name | (6R)-7-butanoyl-6-(2,3-dichlorophenyl)-3-methylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
|---|---|
| PubChem CID | 137189239 |
| Molecular Formula | C21H19Cl2N4O2S+ |
| Molecular Weight | 462.38 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | (6R)-7-butanoyl-6-(2,3-dichlorophenyl)-3-methylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
| SMILES | CCCC(=O)N1c2ccccc2-c2c(=O)[nH]c(SC)n[n+]2[C@@H]1c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C21H18Cl2N4O2S/c1-3-7-16(28)26-15-11-5-4-8-12(15)18-19(29)24-21(30-2)25-27(18)20(26)13-9-6-10-14(22)17(13)23/h4-6,8-11,20H,3,7H2,1-2H3/p+1/t20-/m1/s1 |
| InChIKey | RTGFFSANKANIRQ-HXUWFJFHSA-O |
| XLogP | 4.45 |
| TPSA | 69.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.38 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|