C17H15N4O3S+ — CID 136940246
7-acetyl-6-(furan-2-yl)-3-methylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one (PubChem CID 136940246) has the molecular formula C17H15N4O3S+ and a molecular weight of 355.40 g/mol. Its IUPAC name is 7-acetyl-6-(furan-2-yl)-3-methylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one.
| Compound Name | 7-acetyl-6-(furan-2-yl)-3-methylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
|---|---|
| PubChem CID | 136940246 |
| Molecular Formula | C17H15N4O3S+ |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 7-acetyl-6-(furan-2-yl)-3-methylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
| SMILES | CSc1n[n+]2c(c(=O)[nH]1)-c1ccccc1N(C(C)=O)C2c1ccco1 |
| InChI | InChI=1S/C17H14N4O3S/c1-10(22)20-12-7-4-3-6-11(12)14-15(23)18-17(25-2)19-21(14)16(20)13-8-5-9-24-13/h3-9,16H,1-2H3/p+1 |
| InChIKey | XNYMKAOTIAPHHS-UHFFFAOYSA-O |
| XLogP | 1.95 |
| TPSA | 83.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|