C19H16N5O4S+ — CID 137188868
(6R)-7-acetyl-3-methylsulfanyl-6-(4-nitrophenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one (PubChem CID 137188868) has the molecular formula C19H16N5O4S+ and a molecular weight of 410.44 g/mol. Its IUPAC name is (6R)-7-acetyl-3-methylsulfanyl-6-(4-nitrophenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one.
| Compound Name | (6R)-7-acetyl-3-methylsulfanyl-6-(4-nitrophenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
|---|---|
| PubChem CID | 137188868 |
| Molecular Formula | C19H16N5O4S+ |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | (6R)-7-acetyl-3-methylsulfanyl-6-(4-nitrophenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
| SMILES | CSc1n[n+]2c(c(=O)[nH]1)-c1ccccc1N(C(C)=O)[C@H]2c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H15N5O4S/c1-11(25)22-15-6-4-3-5-14(15)16-17(26)20-19(29-2)21-23(16)18(22)12-7-9-13(10-8-12)24(27)28/h3-10,18H,1-2H3/p+1/t18-/m1/s1 |
| InChIKey | MFDPGUNIRGTHCF-GOSISDBHSA-O |
| XLogP | 2.27 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|