C21H20N5O5S+ — CID 136940344
7-acetyl-6-(2-ethoxy-5-nitrophenyl)-3-methylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one (PubChem CID 136940344) has the molecular formula C21H20N5O5S+ and a molecular weight of 454.49 g/mol. Its IUPAC name is 7-acetyl-6-(2-ethoxy-5-nitrophenyl)-3-methylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one.
| Compound Name | 7-acetyl-6-(2-ethoxy-5-nitrophenyl)-3-methylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
|---|---|
| PubChem CID | 136940344 |
| Molecular Formula | C21H20N5O5S+ |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | 7-acetyl-6-(2-ethoxy-5-nitrophenyl)-3-methylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
| SMILES | CCOc1ccc([N+](=O)[O-])cc1C1N(C(C)=O)c2ccccc2-c2c(=O)[nH]c(SC)n[n+]21 |
| InChI | InChI=1S/C21H19N5O5S/c1-4-31-17-10-9-13(26(29)30)11-15(17)20-24(12(2)27)16-8-6-5-7-14(16)18-19(28)22-21(32-3)23-25(18)20/h5-11,20H,4H2,1-3H3/p+1 |
| InChIKey | VDDHHOATOLUBRK-UHFFFAOYSA-O |
| XLogP | 2.67 |
| TPSA | 122.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|