C24H24BrN4O5S+ — CID 137189591
[2-bromo-6-methoxy-4-[(6S)-3-methylsulfanyl-1-oxo-7-propanoyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-6-yl]phenyl] propanoate (PubChem CID 137189591) has the molecular formula C24H24BrN4O5S+ and a molecular weight of 560.45 g/mol. Its IUPAC name is [2-bromo-6-methoxy-4-[(6S)-3-methylsulfanyl-1-oxo-7-propanoyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-6-yl]phenyl] propanoate.
| Compound Name | [2-bromo-6-methoxy-4-[(6S)-3-methylsulfanyl-1-oxo-7-propanoyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-6-yl]phenyl] propanoate |
|---|---|
| PubChem CID | 137189591 |
| Molecular Formula | C24H24BrN4O5S+ |
| Molecular Weight | 560.45 g/mol |
| Exact Mass | 559.06 |
| IUPAC Name | [2-bromo-6-methoxy-4-[(6S)-3-methylsulfanyl-1-oxo-7-propanoyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-6-yl]phenyl] propanoate |
| SMILES | CCC(=O)Oc1c(Br)cc([C@H]2N(C(=O)CC)c3ccccc3-c3c(=O)[nH]c(SC)n[n+]32)cc1OC |
| InChI | InChI=1S/C24H23BrN4O5S/c1-5-18(30)28-16-10-8-7-9-14(16)20-22(32)26-24(35-4)27-29(20)23(28)13-11-15(25)21(17(12-13)33-3)34-19(31)6-2/h7-12,23H,5-6H2,1-4H3/p+1/t23-/m0/s1 |
| InChIKey | XSDMIQXGDQDVID-QHCPKHFHSA-O |
| XLogP | 3.84 |
| TPSA | 105.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.45 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|