C26H28BrN4O4S+ — CID 136940159
6-(3-bromo-5-ethoxy-4-prop-2-enoxyphenyl)-7-butanoyl-3-methylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one (PubChem CID 136940159) has the molecular formula C26H28BrN4O4S+ and a molecular weight of 572.51 g/mol. Its IUPAC name is 6-(3-bromo-5-ethoxy-4-prop-2-enoxyphenyl)-7-butanoyl-3-methylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one.
| Compound Name | 6-(3-bromo-5-ethoxy-4-prop-2-enoxyphenyl)-7-butanoyl-3-methylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
|---|---|
| PubChem CID | 136940159 |
| Molecular Formula | C26H28BrN4O4S+ |
| Molecular Weight | 572.51 g/mol |
| Exact Mass | 571.10 |
| IUPAC Name | 6-(3-bromo-5-ethoxy-4-prop-2-enoxyphenyl)-7-butanoyl-3-methylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
| SMILES | C=CCOc1c(Br)cc(C2N(C(=O)CCC)c3ccccc3-c3c(=O)[nH]c(SC)n[n+]32)cc1OCC |
| InChI | InChI=1S/C26H27BrN4O4S/c1-5-10-21(32)30-19-12-9-8-11-17(19)22-24(33)28-26(36-4)29-31(22)25(30)16-14-18(27)23(35-13-6-2)20(15-16)34-7-3/h6,8-9,11-12,14-15,25H,2,5,7,10,13H2,1,3-4H3/p+1 |
| InChIKey | XIQVWZZBWROSDW-UHFFFAOYSA-O |
| XLogP | 4.87 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.51 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|