C25H23BrN4O5S — CID 117056974
7-acetyl-6-(2-acetyloxy-5-bromo-3-ethoxyphenyl)-3-prop-2-enylsulfanyl-6H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-olate (PubChem CID 117056974) has the molecular formula C25H23BrN4O5S and a molecular weight of 571.45 g/mol. Its IUPAC name is 7-acetyl-6-(2-acetyloxy-5-bromo-3-ethoxyphenyl)-3-prop-2-enylsulfanyl-6H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-olate.
| Compound Name | 7-acetyl-6-(2-acetyloxy-5-bromo-3-ethoxyphenyl)-3-prop-2-enylsulfanyl-6H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-olate |
|---|---|
| PubChem CID | 117056974 |
| Molecular Formula | C25H23BrN4O5S |
| Molecular Weight | 571.45 g/mol |
| Exact Mass | 570.06 |
| IUPAC Name | 7-acetyl-6-(2-acetyloxy-5-bromo-3-ethoxyphenyl)-3-prop-2-enylsulfanyl-6H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-olate |
| SMILES | C=CCSc1nc([O-])c2[n+](n1)C(c1cc(Br)cc(OCC)c1OC(C)=O)N(C(C)=O)c1ccccc1-2 |
| InChI | InChI=1S/C25H23BrN4O5S/c1-5-11-36-25-27-23(33)21-17-9-7-8-10-19(17)29(14(3)31)24(30(21)28-25)18-12-16(26)13-20(34-6-2)22(18)35-15(4)32/h5,7-10,12-13,24H,1,6,11H2,2-4H3 |
| InChIKey | SHUIPMAMPYKLID-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 108.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|