C21H19ClN4O3S — CID 117056926
6-(5-chloro-2-methoxyphenyl)-3-methylsulfanyl-7-propanoyl-6H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-olate (PubChem CID 117056926) has the molecular formula C21H19ClN4O3S and a molecular weight of 442.93 g/mol. Its IUPAC name is 6-(5-chloro-2-methoxyphenyl)-3-methylsulfanyl-7-propanoyl-6H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-olate.
| Compound Name | 6-(5-chloro-2-methoxyphenyl)-3-methylsulfanyl-7-propanoyl-6H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-olate |
|---|---|
| PubChem CID | 117056926 |
| Molecular Formula | C21H19ClN4O3S |
| Molecular Weight | 442.93 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | 6-(5-chloro-2-methoxyphenyl)-3-methylsulfanyl-7-propanoyl-6H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-olate |
| SMILES | CCC(=O)N1c2ccccc2-c2c([O-])nc(SC)n[n+]2C1c1cc(Cl)ccc1OC |
| InChI | InChI=1S/C21H19ClN4O3S/c1-4-17(27)25-15-8-6-5-7-13(15)18-19(28)23-21(30-3)24-26(18)20(25)14-11-12(22)9-10-16(14)29-2/h5-11,20H,4H2,1-3H3 |
| InChIKey | HBWQGBAUKPJTFC-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 82.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.93 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|