C27H24N4O3S — CID 117057164
3-methylsulfanyl-6-(3-phenylmethoxyphenyl)-7-propanoyl-6H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-olate (PubChem CID 117057164) has the molecular formula C27H24N4O3S and a molecular weight of 484.58 g/mol. Its IUPAC name is 3-methylsulfanyl-6-(3-phenylmethoxyphenyl)-7-propanoyl-6H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-olate.
| Compound Name | 3-methylsulfanyl-6-(3-phenylmethoxyphenyl)-7-propanoyl-6H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-olate |
|---|---|
| PubChem CID | 117057164 |
| Molecular Formula | C27H24N4O3S |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | 3-methylsulfanyl-6-(3-phenylmethoxyphenyl)-7-propanoyl-6H-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-olate |
| SMILES | CCC(=O)N1c2ccccc2-c2c([O-])nc(SC)n[n+]2C1c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C27H24N4O3S/c1-3-23(32)30-22-15-8-7-14-21(22)24-25(33)28-27(35-2)29-31(24)26(30)19-12-9-13-20(16-19)34-17-18-10-5-4-6-11-18/h4-16,26H,3,17H2,1-2H3 |
| InChIKey | STGUCCOGYOHLPZ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 82.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|