C13H24O2Si — CID 117058646
trimethyl-[5-(oxan-2-yloxy)penta-1,2-dienyl]silane (PubChem CID 117058646) has the molecular formula C13H24O2Si and a molecular weight of 240.42 g/mol. Its IUPAC name is trimethyl-[5-(oxan-2-yloxy)penta-1,2-dienyl]silane.
| Compound Name | trimethyl-[5-(oxan-2-yloxy)penta-1,2-dienyl]silane |
|---|---|
| PubChem CID | 117058646 |
| Molecular Formula | C13H24O2Si |
| Molecular Weight | 240.42 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | trimethyl-[5-(oxan-2-yloxy)penta-1,2-dienyl]silane |
| SMILES | C[Si](C)(C)C=C=CCCOC1CCCCO1 |
| InChI | InChI=1S/C13H24O2Si/c1-16(2,3)12-8-4-6-10-14-13-9-5-7-11-15-13/h4,12-13H,5-7,9-11H2,1-3H3 |
| InChIKey | XXJTXPTWZVLYDR-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|