C16H24O3Si — CID 134885227
but-3-enoxy-dimethyl-[5-(oxan-2-yloxy)penta-1,3-diynyl]silane (PubChem CID 134885227) has the molecular formula C16H24O3Si and a molecular weight of 292.45 g/mol. Its IUPAC name is but-3-enoxy-dimethyl-[5-(oxan-2-yloxy)penta-1,3-diynyl]silane.
| Compound Name | but-3-enoxy-dimethyl-[5-(oxan-2-yloxy)penta-1,3-diynyl]silane |
|---|---|
| PubChem CID | 134885227 |
| Molecular Formula | C16H24O3Si |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | but-3-enoxy-dimethyl-[5-(oxan-2-yloxy)penta-1,3-diynyl]silane |
| SMILES | C=CCCO[Si](C)(C)C#CC#CCOC1CCCCO1 |
| InChI | InChI=1S/C16H24O3Si/c1-4-5-14-19-20(2,3)15-10-6-8-12-17-16-11-7-9-13-18-16/h4,16H,1,5,7,9,11-14H2,2-3H3 |
| InChIKey | OUVZFKOOBFINGW-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|