C18H26O2Si — CID 15207685
trimethyl-[(E)-2-methylidene-9-(oxan-2-yloxy)non-5-en-3,7-diynyl]silane (PubChem CID 15207685) has the molecular formula C18H26O2Si and a molecular weight of 302.49 g/mol. Its IUPAC name is trimethyl-[(E)-2-methylidene-9-(oxan-2-yloxy)non-5-en-3,7-diynyl]silane.
| Compound Name | trimethyl-[(E)-2-methylidene-9-(oxan-2-yloxy)non-5-en-3,7-diynyl]silane |
|---|---|
| PubChem CID | 15207685 |
| Molecular Formula | C18H26O2Si |
| Molecular Weight | 302.49 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | trimethyl-[(E)-2-methylidene-9-(oxan-2-yloxy)non-5-en-3,7-diynyl]silane |
| SMILES | C=C(C#C/C=C/C#CCOC1CCCCO1)C[Si](C)(C)C |
| InChI | InChI=1S/C18H26O2Si/c1-17(16-21(2,3)4)12-8-6-5-7-10-14-19-18-13-9-11-15-20-18/h5-6,18H,1,9,11,13-16H2,2-4H3/b6-5+ |
| InChIKey | OVIFYBAMOZRULR-AATRIKPKSA-N |
| XLogP | 3.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.49 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|