C17H26O3Si — CID 134885323
dimethyl-[5-(oxan-2-yloxy)penta-1,3-diynyl]-pent-4-enoxysilane (PubChem CID 134885323) has the molecular formula C17H26O3Si and a molecular weight of 306.48 g/mol. Its IUPAC name is dimethyl-[5-(oxan-2-yloxy)penta-1,3-diynyl]-pent-4-enoxysilane.
| Compound Name | dimethyl-[5-(oxan-2-yloxy)penta-1,3-diynyl]-pent-4-enoxysilane |
|---|---|
| PubChem CID | 134885323 |
| Molecular Formula | C17H26O3Si |
| Molecular Weight | 306.48 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | dimethyl-[5-(oxan-2-yloxy)penta-1,3-diynyl]-pent-4-enoxysilane |
| SMILES | C=CCCCO[Si](C)(C)C#CC#CCOC1CCCCO1 |
| InChI | InChI=1S/C17H26O3Si/c1-4-5-8-15-20-21(2,3)16-11-6-9-13-18-17-12-7-10-14-19-17/h4,17H,1,5,7-8,10,12-15H2,2-3H3 |
| InChIKey | WTHGFHBPTQLZST-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.48 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|